C23H22O6 — CID 163090727
2-[(3-hydroxy-4-methoxyphenyl)methylidene]-9-(2-methylpropyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163090727) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[(3-hydroxy-4-methoxyphenyl)methylidene]-9-(2-methylpropyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-[(3-hydroxy-4-methoxyphenyl)methylidene]-9-(2-methylpropyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163090727 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[(3-hydroxy-4-methoxyphenyl)methylidene]-9-(2-methylpropyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(C=C2Oc3c(ccc4c3C(CC(C)C)CC(=O)O4)C2=O)cc1O |
| InChI | InChI=1S/C23H22O6/c1-12(2)8-14-11-20(25)28-18-7-5-15-22(26)19(29-23(15)21(14)18)10-13-4-6-17(27-3)16(24)9-13/h4-7,9-10,12,14,24H,8,11H2,1-3H3 |
| InChIKey | VYVHZBDUVNIVOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|