C29H26O7 — CID 99995987
(2Z,9R)-2-[(4-methoxyphenyl)methylidene]-9-(3-methoxy-4-propan-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 99995987) has the molecular formula C29H26O7 and a molecular weight of 486.52 g/mol. Its IUPAC name is (2Z,9R)-2-[(4-methoxyphenyl)methylidene]-9-(3-methoxy-4-propan-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-2-[(4-methoxyphenyl)methylidene]-9-(3-methoxy-4-propan-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 99995987 |
| Molecular Formula | C29H26O7 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (2Z,9R)-2-[(4-methoxyphenyl)methylidene]-9-(3-methoxy-4-propan-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3[C@@H](c3ccc(OC(C)C)c(OC)c3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C29H26O7/c1-16(2)34-22-11-7-18(14-24(22)33-4)21-15-26(30)35-23-12-10-20-28(31)25(36-29(20)27(21)23)13-17-5-8-19(32-3)9-6-17/h5-14,16,21H,15H2,1-4H3/b25-13-/t21-/m1/s1 |
| InChIKey | SJDOQYDUWCPHAV-CWOJIVPFSA-N |
| XLogP | 5.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|