C29H24O9 — CID 99984054
[2,6-dimethoxy-4-[(2E,9S)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenyl] acetate (PubChem CID 99984054) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(2E,9S)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(2E,9S)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenyl] acetate |
|---|---|
| PubChem CID | 99984054 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [2,6-dimethoxy-4-[(2E,9S)-2-[(4-methoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenyl] acetate |
| SMILES | COc1ccc(/C=C2/Oc3c(ccc4c3[C@H](c3cc(OC)c(OC(C)=O)c(OC)c3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C29H24O9/c1-15(30)36-29-23(34-3)12-17(13-24(29)35-4)20-14-25(31)37-21-10-9-19-27(32)22(38-28(19)26(20)21)11-16-5-7-18(33-2)8-6-16/h5-13,20H,14H2,1-4H3/b22-11+/t20-/m0/s1 |
| InChIKey | UHHBEMKPDQTKSF-OKFCBPFISA-N |
| XLogP | 4.69 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|