C26H20O7 — CID 127252858
(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 127252858) has the molecular formula C26H20O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 127252858 |
| Molecular Formula | C26H20O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (2Z)-2-[(3,4-dimethoxyphenyl)methylidene]-9-(4-hydroxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc4c3C(c3ccc(O)cc3)CC(=O)O4)C2=O)cc1OC |
| InChI | InChI=1S/C26H20O7/c1-30-19-9-3-14(11-21(19)31-2)12-22-25(29)17-8-10-20-24(26(17)33-22)18(13-23(28)32-20)15-4-6-16(27)7-5-15/h3-12,18,27H,13H2,1-2H3/b22-12- |
| InChIKey | WHNYOFYDALXAKL-UUYOSTAYSA-N |
| XLogP | 4.47 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|