C24H18O7 — CID 124879691
(2Z,9S)-9-(3,4-dimethoxyphenyl)-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124879691) has the molecular formula C24H18O7 and a molecular weight of 418.40 g/mol. Its IUPAC name is (2Z,9S)-9-(3,4-dimethoxyphenyl)-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-(3,4-dimethoxyphenyl)-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124879691 |
| Molecular Formula | C24H18O7 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (2Z,9S)-9-(3,4-dimethoxyphenyl)-2-(furan-2-ylmethylidene)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccco2)C4=O)cc1OC |
| InChI | InChI=1S/C24H18O7/c1-27-17-7-5-13(10-19(17)28-2)16-12-21(25)30-18-8-6-15-23(26)20(31-24(15)22(16)18)11-14-4-3-9-29-14/h3-11,16H,12H2,1-2H3/b20-11-/t16-/m0/s1 |
| InChIKey | VMEIMXFVXLAXGI-VBNMEBLOSA-N |
| XLogP | 4.35 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|