C27H20O8 — CID 102565175
(2Z)-9-(1,3-benzodioxol-5-yl)-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 102565175) has the molecular formula C27H20O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is (2Z)-9-(1,3-benzodioxol-5-yl)-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-9-(1,3-benzodioxol-5-yl)-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 102565175 |
| Molecular Formula | C27H20O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (2Z)-9-(1,3-benzodioxol-5-yl)-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cccc(/C=C2\Oc3c(ccc4c3C(c3ccc5c(c3)OCO5)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C27H20O8/c1-30-20-5-3-4-15(26(20)31-2)11-22-25(29)16-7-9-19-24(27(16)35-22)17(12-23(28)34-19)14-6-8-18-21(10-14)33-13-32-18/h3-11,17H,12-13H2,1-2H3/b22-11- |
| InChIKey | SMCJGINDTRCLOE-JJFYIABZSA-N |
| XLogP | 4.49 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|