C30H22O8 — CID 102564621
(2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 102564621) has the molecular formula C30H22O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is (2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 102564621 |
| Molecular Formula | C30H22O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (2Z)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(6-methyl-4-oxochromen-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cccc(/C=C2\Oc3c(ccc4c3C(c3coc5ccc(C)cc5c3=O)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C30H22O8/c1-15-7-9-21-19(11-15)27(32)20(14-36-21)18-13-25(31)37-22-10-8-17-28(33)24(38-30(17)26(18)22)12-16-5-4-6-23(34-2)29(16)35-3/h4-12,14,18H,13H2,1-3H3/b24-12- |
| InChIKey | YOLHRVRSZUPKAB-MSXFZWOLSA-N |
| XLogP | 5.18 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|