C30H23NO7 — CID 163079688
2-[(2,3-dimethoxyphenyl)methylidene]-9-(1-methyl-2-oxoquinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163079688) has the molecular formula C30H23NO7 and a molecular weight of 509.51 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methylidene]-9-(1-methyl-2-oxoquinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methylidene]-9-(1-methyl-2-oxoquinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163079688 |
| Molecular Formula | C30H23NO7 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methylidene]-9-(1-methyl-2-oxoquinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cccc(C=C2Oc3c(ccc4c3C(c3cc5ccccc5n(C)c3=O)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C30H23NO7/c1-31-21-9-5-4-7-16(21)13-20(30(31)34)19-15-25(32)37-22-12-11-18-27(33)24(38-29(18)26(19)22)14-17-8-6-10-23(35-2)28(17)36-3/h4-14,19H,15H2,1-3H3 |
| InChIKey | BUFHVOIFNGXIKQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|