C27H20O8 — CID 163018952
4-[2-[(2,3-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid (PubChem CID 163018952) has the molecular formula C27H20O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is 4-[2-[(2,3-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid.
| Compound Name | 4-[2-[(2,3-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 163018952 |
| Molecular Formula | C27H20O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4-[2-[(2,3-dimethoxyphenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid |
| SMILES | COc1cccc(C=C2Oc3c(ccc4c3C(c3ccc(C(=O)O)cc3)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C27H20O8/c1-32-20-5-3-4-16(25(20)33-2)12-21-24(29)17-10-11-19-23(26(17)35-21)18(13-22(28)34-19)14-6-8-15(9-7-14)27(30)31/h3-12,18H,13H2,1-2H3,(H,30,31) |
| InChIKey | RKUFXHKFDMLOHE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|