C27H20F2O7 — CID 102564857
(2Z)-9-[3-(difluoromethoxy)phenyl]-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 102564857) has the molecular formula C27H20F2O7 and a molecular weight of 494.45 g/mol. Its IUPAC name is (2Z)-9-[3-(difluoromethoxy)phenyl]-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-9-[3-(difluoromethoxy)phenyl]-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 102564857 |
| Molecular Formula | C27H20F2O7 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (2Z)-9-[3-(difluoromethoxy)phenyl]-2-[(2,3-dimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cccc(/C=C2\Oc3c(ccc4c3C(c3cccc(OC(F)F)c3)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C27H20F2O7/c1-32-20-8-4-6-15(25(20)33-2)12-21-24(31)17-9-10-19-23(26(17)36-21)18(13-22(30)35-19)14-5-3-7-16(11-14)34-27(28)29/h3-12,18,27H,13H2,1-2H3/b21-12- |
| InChIKey | XGMQDGFSZWNWIT-MTJSOVHGSA-N |
| XLogP | 5.36 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|