C29H21NO7 — CID 99998041
(2Z,9S)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 99998041) has the molecular formula C29H21NO7 and a molecular weight of 495.49 g/mol. Its IUPAC name is (2Z,9S)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 99998041 |
| Molecular Formula | C29H21NO7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (2Z,9S)-2-[(2,3-dimethoxyphenyl)methylidene]-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cccc(/C=C2\Oc3c(ccc4c3[C@@H](c3cc5ccccc5[nH]c3=O)CC(=O)O4)C2=O)c1OC |
| InChI | InChI=1S/C29H21NO7/c1-34-22-9-5-7-16(27(22)35-2)13-23-26(32)17-10-11-21-25(28(17)37-23)18(14-24(31)36-21)19-12-15-6-3-4-8-20(15)30-29(19)33/h3-13,18H,14H2,1-2H3,(H,30,33)/b23-13-/t18-/m1/s1 |
| InChIKey | AYHMREYQNIQPOI-VLZFXTDASA-N |
| XLogP | 4.60 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|