C31H25NO9 — CID 125122383
(2Z,9R)-9-(7-methoxy-2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125122383) has the molecular formula C31H25NO9 and a molecular weight of 555.54 g/mol. Its IUPAC name is (2Z,9R)-9-(7-methoxy-2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(7-methoxy-2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125122383 |
| Molecular Formula | C31H25NO9 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | (2Z,9R)-9-(7-methoxy-2-oxo-1H-quinolin-3-yl)-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1ccc2cc([C@@H]3CC(=O)Oc4ccc5c(c43)O/C(=C\c3cc(OC)c(OC)cc3OC)C5=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C31H25NO9/c1-36-17-6-5-15-9-20(31(35)32-21(15)12-17)19-13-27(33)40-22-8-7-18-29(34)26(41-30(18)28(19)22)11-16-10-24(38-3)25(39-4)14-23(16)37-2/h5-12,14,19H,13H2,1-4H3,(H,32,35)/b26-11-/t19-/m0/s1 |
| InChIKey | ITUZLFVORDADMQ-CEXQZHQISA-N |
| XLogP | 4.62 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|