C27H17NO5 — CID 125123081
(2Z,9R)-2-benzylidene-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125123081) has the molecular formula C27H17NO5 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2Z,9R)-2-benzylidene-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-2-benzylidene-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125123081 |
| Molecular Formula | C27H17NO5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2Z,9R)-2-benzylidene-9-(2-oxo-1H-quinolin-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1C[C@@H](c2cc3ccccc3[nH]c2=O)c2c(ccc3c2O/C(=C\c2ccccc2)C3=O)O1 |
| InChI | InChI=1S/C27H17NO5/c29-23-14-18(19-13-16-8-4-5-9-20(16)28-27(19)31)24-21(32-23)11-10-17-25(30)22(33-26(17)24)12-15-6-2-1-3-7-15/h1-13,18H,14H2,(H,28,31)/b22-12-/t18-/m0/s1 |
| InChIKey | VBGOMNXTMVOJKL-AIRTYWKNSA-N |
| XLogP | 4.59 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|