C26H18O6 — CID 110206822
(2Z)-2-benzylidene-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 110206822) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is (2Z)-2-benzylidene-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z)-2-benzylidene-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 110206822 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (2Z)-2-benzylidene-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1CC(c2ccc3c(c2)OCCO3)c2c(ccc3c2O/C(=C\c2ccccc2)C3=O)O1 |
| InChI | InChI=1S/C26H18O6/c27-23-14-18(16-6-8-19-21(13-16)30-11-10-29-19)24-20(31-23)9-7-17-25(28)22(32-26(17)24)12-15-4-2-1-3-5-15/h1-9,12-13,18H,10-11,14H2/b22-12- |
| InChIKey | PBEIQOHEVDOHKC-UUYOSTAYSA-N |
| XLogP | 4.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|