C28H22O6 — CID 125428918
(2Z,9R)-9-(1,3-benzodioxol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125428918) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is (2Z,9R)-9-(1,3-benzodioxol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9R)-9-(1,3-benzodioxol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125428918 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2Z,9R)-9-(1,3-benzodioxol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)c1ccc(/C=C2\Oc3c(ccc4c3[C@@H](c3ccc5c(c3)OCO5)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C28H22O6/c1-15(2)17-5-3-16(4-6-17)11-24-27(30)19-8-10-22-26(28(19)34-24)20(13-25(29)33-22)18-7-9-21-23(12-18)32-14-31-21/h3-12,15,20H,13-14H2,1-2H3/b24-11-/t20-/m1/s1 |
| InChIKey | FAKJJTAOINKPKK-ULDGNCBVSA-N |
| XLogP | 5.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|