C31H24N2O5 — CID 125427950
(2Z,9S)-2-[(4-propan-2-ylphenyl)methylidene]-9-(3-pyrimidin-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125427950) has the molecular formula C31H24N2O5 and a molecular weight of 504.54 g/mol. Its IUPAC name is (2Z,9S)-2-[(4-propan-2-ylphenyl)methylidene]-9-(3-pyrimidin-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-[(4-propan-2-ylphenyl)methylidene]-9-(3-pyrimidin-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125427950 |
| Molecular Formula | C31H24N2O5 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (2Z,9S)-2-[(4-propan-2-ylphenyl)methylidene]-9-(3-pyrimidin-2-yloxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)c1ccc(/C=C2\Oc3c(ccc4c3[C@H](c3cccc(Oc5ncccn5)c3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C31H24N2O5/c1-18(2)20-9-7-19(8-10-20)15-26-29(35)23-11-12-25-28(30(23)38-26)24(17-27(34)37-25)21-5-3-6-22(16-21)36-31-32-13-4-14-33-31/h3-16,18,24H,17H2,1-2H3/b26-15-/t24-/m0/s1 |
| InChIKey | PASWQFSGRBJASG-NMKJEIPESA-N |
| XLogP | 6.45 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|