C32H23NO7 — CID 163091452
methyl 4-[[3,7-dioxo-9-[3-(pyridin-3-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate (PubChem CID 163091452) has the molecular formula C32H23NO7 and a molecular weight of 533.54 g/mol. Its IUPAC name is methyl 4-[[3,7-dioxo-9-[3-(pyridin-3-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3,7-dioxo-9-[3-(pyridin-3-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 163091452 |
| Molecular Formula | C32H23NO7 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | methyl 4-[[3,7-dioxo-9-[3-(pyridin-3-ylmethoxy)phenyl]-8,9-dihydrofuro[2,3-f]chromen-2-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2Oc3c(ccc4c3C(c3cccc(OCc5cccnc5)c3)CC(=O)O4)C2=O)cc1 |
| InChI | InChI=1S/C32H23NO7/c1-37-32(36)21-9-7-19(8-10-21)14-27-30(35)24-11-12-26-29(31(24)40-27)25(16-28(34)39-26)22-5-2-6-23(15-22)38-18-20-4-3-13-33-17-20/h2-15,17,25H,16,18H2,1H3 |
| InChIKey | PYFNTDJRJMDQKQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|