C30H24N2O7 — CID 125122743
2-[3-[(2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide (PubChem CID 125122743) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is 2-[3-[(2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide.
| Compound Name | 2-[3-[(2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 125122743 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[3-[(2Z,9S)-2-[(5-methoxy-1-methylindol-3-yl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]phenoxy]acetamide |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3c(ccc4c3[C@H](c3cccc(OCC(N)=O)c3)CC(=O)O4)C1=O)cn2C |
| InChI | InChI=1S/C30H24N2O7/c1-32-14-17(21-12-18(36-2)6-8-23(21)32)11-25-29(35)20-7-9-24-28(30(20)39-25)22(13-27(34)38-24)16-4-3-5-19(10-16)37-15-26(31)33/h3-12,14,22H,13,15H2,1-2H3,(H2,31,33)/b25-11-/t22-/m0/s1 |
| InChIKey | OMBVCKBFHKWSBQ-NSCDVIQISA-N |
| XLogP | 4.11 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|