C28H19NO6 — CID 163027253
9-(1,3-benzodioxol-5-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163027253) has the molecular formula C28H19NO6 and a molecular weight of 465.46 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163027253 |
| Molecular Formula | C28H19NO6 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | Cn1cc(C=C2Oc3c(ccc4c3C(c3ccc5c(c3)OCO5)CC(=O)O4)C2=O)c2ccccc21 |
| InChI | InChI=1S/C28H19NO6/c1-29-13-16(17-4-2-3-5-20(17)29)11-24-27(31)18-7-9-22-26(28(18)35-24)19(12-25(30)34-22)15-6-8-21-23(10-15)33-14-32-21/h2-11,13,19H,12,14H2,1H3 |
| InChIKey | MTGWZFWEIDFPEI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|