C25H17NO5 — CID 124876614
(2Z,9S)-9-(furan-2-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 124876614) has the molecular formula C25H17NO5 and a molecular weight of 411.41 g/mol. Its IUPAC name is (2Z,9S)-9-(furan-2-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-9-(furan-2-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 124876614 |
| Molecular Formula | C25H17NO5 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (2Z,9S)-9-(furan-2-yl)-2-[(1-methylindol-3-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | Cn1cc(/C=C2\Oc3c(ccc4c3[C@@H](c3ccco3)CC(=O)O4)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H17NO5/c1-26-13-14(15-5-2-3-6-18(15)26)11-21-24(28)16-8-9-20-23(25(16)31-21)17(12-22(27)30-20)19-7-4-10-29-19/h2-11,13,17H,12H2,1H3/b21-11-/t17-/m1/s1 |
| InChIKey | GJXFAKFEDJRPRS-BYINCCNUSA-N |
| XLogP | 4.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|