C27H20N2O5 — CID 124879538
methyl 2-[(9R,13Z)-13-[(1-methylindol-3-yl)methylidene]-14-oxo-2,12-dioxa-4-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11(15),16-hexaen-9-yl]acetate (PubChem CID 124879538) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is methyl 2-[(9R,13Z)-13-[(1-methylindol-3-yl)methylidene]-14-oxo-2,12-dioxa-4-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11(15),16-hexaen-9-yl]acetate.
| Compound Name | methyl 2-[(9R,13Z)-13-[(1-methylindol-3-yl)methylidene]-14-oxo-2,12-dioxa-4-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11(15),16-hexaen-9-yl]acetate |
|---|---|
| PubChem CID | 124879538 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl 2-[(9R,13Z)-13-[(1-methylindol-3-yl)methylidene]-14-oxo-2,12-dioxa-4-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6,11(15),16-hexaen-9-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2cccnc2Oc2ccc3c(c21)O/C(=C\c1cn(C)c2ccccc12)C3=O |
| InChI | InChI=1S/C27H20N2O5/c1-29-14-15(16-6-3-4-8-20(16)29)12-22-25(31)18-9-10-21-24(26(18)33-22)19(13-23(30)32-2)17-7-5-11-28-27(17)34-21/h3-12,14,19H,13H2,1-2H3/b22-12-/t19-/m0/s1 |
| InChIKey | UKRGTTNCQLYCTO-ZIHVZMLCSA-N |
| XLogP | 4.99 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|