C28H25NO3 — CID 35494042
(2Z)-6-[(2,5-dimethylphenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 35494042) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2Z)-6-[(2,5-dimethylphenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2,5-dimethylphenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35494042 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (2Z)-6-[(2,5-dimethylphenyl)methoxy]-7-methyl-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccc(C)c(COc2ccc3c(c2C)O/C(=C\c2cn(C)c4ccccc24)C3=O)c1 |
| InChI | InChI=1S/C28H25NO3/c1-17-9-10-18(2)21(13-17)16-31-25-12-11-23-27(30)26(32-28(23)19(25)3)14-20-15-29(4)24-8-6-5-7-22(20)24/h5-15H,16H2,1-4H3/b26-14- |
| InChIKey | RIEISXWLFJQRSI-WGARJPEWSA-N |
| XLogP | 6.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|