C25H18ClNO3 — CID 35493973
(2Z)-6-[(3-chlorophenyl)methoxy]-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 35493973) has the molecular formula C25H18ClNO3 and a molecular weight of 415.88 g/mol. Its IUPAC name is (2Z)-6-[(3-chlorophenyl)methoxy]-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(3-chlorophenyl)methoxy]-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 35493973 |
| Molecular Formula | C25H18ClNO3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2Z)-6-[(3-chlorophenyl)methoxy]-2-[(1-methylindol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cn1cc(/C=C2\Oc3cc(OCc4cccc(Cl)c4)ccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H18ClNO3/c1-27-14-17(20-7-2-3-8-22(20)27)12-24-25(28)21-10-9-19(13-23(21)30-24)29-15-16-5-4-6-18(26)11-16/h2-14H,15H2,1H3/b24-12- |
| InChIKey | QCAMHPUNGSPIBN-MSXFZWOLSA-N |
| XLogP | 6.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|