C24H19ClO5 — CID 3691846
6-[(3-chlorophenyl)methoxy]-2-[(2,5-dimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 3691846) has the molecular formula C24H19ClO5 and a molecular weight of 422.86 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methoxy]-2-[(2,5-dimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(3-chlorophenyl)methoxy]-2-[(2,5-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 3691846 |
| Molecular Formula | C24H19ClO5 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 6-[(3-chlorophenyl)methoxy]-2-[(2,5-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(OC)c(C=C2Oc3cc(OCc4cccc(Cl)c4)ccc3C2=O)c1 |
| InChI | InChI=1S/C24H19ClO5/c1-27-18-7-9-21(28-2)16(11-18)12-23-24(26)20-8-6-19(13-22(20)30-23)29-14-15-4-3-5-17(25)10-15/h3-13H,14H2,1-2H3 |
| InChIKey | JLHHFDQMDCGZAR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|