C23H16Cl2O4 — CID 6317826
(2Z)-2-[(2,4-dichlorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6317826) has the molecular formula C23H16Cl2O4 and a molecular weight of 427.28 g/mol. Its IUPAC name is (2Z)-2-[(2,4-dichlorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2,4-dichlorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6317826 |
| Molecular Formula | C23H16Cl2O4 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (2Z)-2-[(2,4-dichlorophenyl)methylidene]-6-[(4-methoxyphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(COc2ccc3c(c2)O/C(=C\c2ccc(Cl)cc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C23H16Cl2O4/c1-27-17-6-2-14(3-7-17)13-28-18-8-9-19-21(12-18)29-22(23(19)26)10-15-4-5-16(24)11-20(15)25/h2-12H,13H2,1H3/b22-10- |
| InChIKey | PTWCWQYAMICHQV-YVNNLAQVSA-N |
| XLogP | 6.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|