C17H12Cl2N2O4 — CID 4973657
2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetohydrazide (PubChem CID 4973657) has the molecular formula C17H12Cl2N2O4 and a molecular weight of 379.20 g/mol. Its IUPAC name is 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetohydrazide.
| Compound Name | 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetohydrazide |
|---|---|
| PubChem CID | 4973657 |
| Molecular Formula | C17H12Cl2N2O4 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-[[2-[(2,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetohydrazide |
| SMILES | NNC(=O)COc1ccc2c(c1)OC(=Cc1ccc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C17H12Cl2N2O4/c18-10-2-1-9(13(19)6-10)5-15-17(23)12-4-3-11(7-14(12)25-15)24-8-16(22)21-20/h1-7H,8,20H2,(H,21,22) |
| InChIKey | CJJVQRPEWWDQEE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|