C23H13Cl3O4 — CID 4861175
6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(2,3-dichlorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 4861175) has the molecular formula C23H13Cl3O4 and a molecular weight of 459.71 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(2,3-dichlorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(2,3-dichlorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4861175 |
| Molecular Formula | C23H13Cl3O4 |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(2,3-dichlorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C(COc1ccc2c(c1)OC(=Cc1cccc(Cl)c1Cl)C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H13Cl3O4/c24-15-6-4-13(5-7-15)19(27)12-29-16-8-9-17-20(11-16)30-21(23(17)28)10-14-2-1-3-18(25)22(14)26/h1-11H,12H2 |
| InChIKey | GCEYHEZHTZTKSF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|