C18H12Cl2O4 — CID 6198889
[(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] propanoate (PubChem CID 6198889) has the molecular formula C18H12Cl2O4 and a molecular weight of 363.20 g/mol. Its IUPAC name is [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] propanoate.
| Compound Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] propanoate |
|---|---|
| PubChem CID | 6198889 |
| Molecular Formula | C18H12Cl2O4 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc2c(c1)O/C(=C\c1cccc(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C18H12Cl2O4/c1-2-16(21)23-11-6-7-12-14(9-11)24-15(18(12)22)8-10-4-3-5-13(19)17(10)20/h3-9H,2H2,1H3/b15-8- |
| InChIKey | GERZRUAMLSNGLF-NVNXTCNLSA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|