About [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate
[(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate (PubChem CID 6220361) has the molecular formula C16H10Cl2O5S
and a molecular weight of 385.22 g/mol. Its IUPAC name is [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate |
| PubChem CID | 6220361 |
| Molecular Formula | C16H10Cl2O5S |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)O/C(=C\c1cccc(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C16H10Cl2O5S/c1-24(20,21)23-10-5-6-11-13(8-10)22-14(16(11)19)7-9-3-2-4-12(17)15(9)18/h2-8H,1H3/b14-7- |
| InChIKey | LFCUCCPAWKHFDW-AUWJEWJLSA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate?
The IUPAC name of [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate (CID 6220361) is [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate.
What is the SMILES notation for [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate?
The canonical SMILES for [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate is CS(=O)(=O)Oc1ccc2c(c1)O/C(=C\c1cccc(Cl)c1Cl)C2=O.
What is the InChIKey of [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate?
The InChIKey is LFCUCCPAWKHFDW-AUWJEWJLSA-N. The full InChI is InChI=1S/C16H10Cl2O5S/c1-24(20,21)23-10-5-6-11-13(8-10)22-14(16(11)19)7-9-3-2-4-12(17)15(9)18/h2-8H,1H3/b14-7-.
What are the key properties of [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate?
[(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate has a molecular weight of 385.22 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate is sourced from PubChem (CID 6220361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).