C24H14Cl2O4 — CID 4729584
[2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3-phenylprop-2-enoate (PubChem CID 4729584) has the molecular formula C24H14Cl2O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is [2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3-phenylprop-2-enoate.
| Compound Name | [2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4729584 |
| Molecular Formula | C24H14Cl2O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)Oc1ccc2c(c1)OC(=Cc1cccc(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C24H14Cl2O4/c25-19-8-4-7-16(23(19)26)13-21-24(28)18-11-10-17(14-20(18)30-21)29-22(27)12-9-15-5-2-1-3-6-15/h1-14H |
| InChIKey | BFFHSVGDRSDFNX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|