C20H10Cl2O5 — CID 19260801
[(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] furan-2-carboxylate (PubChem CID 19260801) has the molecular formula C20H10Cl2O5 and a molecular weight of 401.20 g/mol. Its IUPAC name is [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] furan-2-carboxylate.
| Compound Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19260801 |
| Molecular Formula | C20H10Cl2O5 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | [(2Z)-2-[(2,3-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)O/C(=C\c1cccc(Cl)c1Cl)C2=O)c1ccco1 |
| InChI | InChI=1S/C20H10Cl2O5/c21-14-4-1-3-11(18(14)22)9-17-19(23)13-7-6-12(10-16(13)27-17)26-20(24)15-5-2-8-25-15/h1-10H/b17-9- |
| InChIKey | RPQDXPUTYRWGOM-MFOYZWKCSA-N |
| XLogP | 5.42 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|