C22H13Cl2FO3 — CID 6220422
(2Z)-2-[(2,3-dichlorophenyl)methylidene]-6-[(2-fluorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6220422) has the molecular formula C22H13Cl2FO3 and a molecular weight of 415.25 g/mol. Its IUPAC name is (2Z)-2-[(2,3-dichlorophenyl)methylidene]-6-[(2-fluorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2,3-dichlorophenyl)methylidene]-6-[(2-fluorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6220422 |
| Molecular Formula | C22H13Cl2FO3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (2Z)-2-[(2,3-dichlorophenyl)methylidene]-6-[(2-fluorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2cccc(Cl)c2Cl)Oc2cc(OCc3ccccc3F)ccc21 |
| InChI | InChI=1S/C22H13Cl2FO3/c23-17-6-3-5-13(21(17)24)10-20-22(26)16-9-8-15(11-19(16)28-20)27-12-14-4-1-2-7-18(14)25/h1-11H,12H2/b20-10- |
| InChIKey | QIVUMAHUQDRMIO-JMIUGGIZSA-N |
| XLogP | 6.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|