C22H10F6O3 — CID 5266068
2-[(2-fluorophenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 5266068) has the molecular formula C22H10F6O3 and a molecular weight of 436.31 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | 2-[(2-fluorophenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266068 |
| Molecular Formula | C22H10F6O3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[(2-fluorophenyl)methylidene]-6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccccc2F)Oc2cc(OCc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C22H10F6O3/c23-14-4-2-1-3-10(14)7-16-22(29)12-6-5-11(8-15(12)31-16)30-9-13-17(24)19(26)21(28)20(27)18(13)25/h1-8H,9H2 |
| InChIKey | XHMRZVUQSPAIOW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|