C25H17F5O6 — CID 5266094
6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5266094) has the molecular formula C25H17F5O6 and a molecular weight of 508.40 g/mol. Its IUPAC name is 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5266094 |
| Molecular Formula | C25H17F5O6 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 6-[(2,3,4,5,6-pentafluorophenyl)methoxy]-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1cc(C=C2Oc3cc(OCc4c(F)c(F)c(F)c(F)c4F)ccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H17F5O6/c1-32-17-7-11(8-18(33-2)25(17)34-3)6-16-24(31)13-5-4-12(9-15(13)36-16)35-10-14-19(26)21(28)23(30)22(29)20(14)27/h4-9H,10H2,1-3H3 |
| InChIKey | RBYFGLLXOOWRBU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|