C24H18Cl2O5 — CID 5265875
6-[(3,4-dichlorophenyl)methoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5265875) has the molecular formula C24H18Cl2O5 and a molecular weight of 457.31 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(3,4-dichlorophenyl)methoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5265875 |
| Molecular Formula | C24H18Cl2O5 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methoxy]-2-[(3,4-dimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(C=C2Oc3cc(OCc4ccc(Cl)c(Cl)c4)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C24H18Cl2O5/c1-28-20-8-4-14(10-22(20)29-2)11-23-24(27)17-6-5-16(12-21(17)31-23)30-13-15-3-7-18(25)19(26)9-15/h3-12H,13H2,1-2H3 |
| InChIKey | LPMGKODKHQZCCJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|