C22H13Cl2NO5 — CID 2017519
(2Z)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-nitrophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 2017519) has the molecular formula C22H13Cl2NO5 and a molecular weight of 442.25 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-nitrophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-nitrophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2017519 |
| Molecular Formula | C22H13Cl2NO5 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | (2Z)-2-[(3,4-dichlorophenyl)methylidene]-6-[(4-nitrophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)Oc2cc(OCc3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C22H13Cl2NO5/c23-18-8-3-14(9-19(18)24)10-21-22(26)17-7-6-16(11-20(17)30-21)29-12-13-1-4-15(5-2-13)25(27)28/h1-11H,12H2/b21-10- |
| InChIKey | VBWBKEVGBGLJPN-FBHDLOMBSA-N |
| XLogP | 6.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|