C22H12Cl3FO3 — CID 4861245
6-[(2-chloro-4-fluorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 4861245) has the molecular formula C22H12Cl3FO3 and a molecular weight of 449.69 g/mol. Its IUPAC name is 6-[(2-chloro-4-fluorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2-chloro-4-fluorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4861245 |
| Molecular Formula | C22H12Cl3FO3 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | 6-[(2-chloro-4-fluorophenyl)methoxy]-2-[(3,4-dichlorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccc(Cl)c(Cl)c2)Oc2cc(OCc3ccc(F)cc3Cl)ccc21 |
| InChI | InChI=1S/C22H12Cl3FO3/c23-17-6-1-12(7-19(17)25)8-21-22(27)16-5-4-15(10-20(16)29-21)28-11-13-2-3-14(26)9-18(13)24/h1-10H,11H2 |
| InChIKey | WYFROSJTHGDDCY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|