C24H15ClFNO3 — CID 3787607
6-[(2-chloro-4-fluorophenyl)methoxy]-2-(1H-indol-3-ylmethylidene)-1-benzofuran-3-one (PubChem CID 3787607) has the molecular formula C24H15ClFNO3 and a molecular weight of 419.84 g/mol. Its IUPAC name is 6-[(2-chloro-4-fluorophenyl)methoxy]-2-(1H-indol-3-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | 6-[(2-chloro-4-fluorophenyl)methoxy]-2-(1H-indol-3-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 3787607 |
| Molecular Formula | C24H15ClFNO3 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 6-[(2-chloro-4-fluorophenyl)methoxy]-2-(1H-indol-3-ylmethylidene)-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2c[nH]c3ccccc23)Oc2cc(OCc3ccc(F)cc3Cl)ccc21 |
| InChI | InChI=1S/C24H15ClFNO3/c25-20-10-16(26)6-5-14(20)13-29-17-7-8-19-22(11-17)30-23(24(19)28)9-15-12-27-21-4-2-1-3-18(15)21/h1-12,27H,13H2 |
| InChIKey | DGOBCKCLMGHYRI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|