C24H18Cl2O4 — CID 5265863
6-[(2,4-dichlorophenyl)methoxy]-2-[(2-ethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 5265863) has the molecular formula C24H18Cl2O4 and a molecular weight of 441.31 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methoxy]-2-[(2-ethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(2,4-dichlorophenyl)methoxy]-2-[(2-ethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5265863 |
| Molecular Formula | C24H18Cl2O4 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methoxy]-2-[(2-ethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | CCOc1ccccc1C=C1Oc2cc(OCc3ccc(Cl)cc3Cl)ccc2C1=O |
| InChI | InChI=1S/C24H18Cl2O4/c1-2-28-21-6-4-3-5-15(21)11-23-24(27)19-10-9-18(13-22(19)30-23)29-14-16-7-8-17(25)12-20(16)26/h3-13H,2,14H2,1H3 |
| InChIKey | SGKXTISABOOFDZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|