C19H17ClO3 — CID 18823500
(2Z)-2-[(2-butoxyphenyl)methylidene]-5-chloro-1-benzofuran-3-one (PubChem CID 18823500) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is (2Z)-2-[(2-butoxyphenyl)methylidene]-5-chloro-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2-butoxyphenyl)methylidene]-5-chloro-1-benzofuran-3-one |
|---|---|
| PubChem CID | 18823500 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (2Z)-2-[(2-butoxyphenyl)methylidene]-5-chloro-1-benzofuran-3-one |
| SMILES | CCCCOc1ccccc1/C=C1\Oc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C19H17ClO3/c1-2-3-10-22-16-7-5-4-6-13(16)11-18-19(21)15-12-14(20)8-9-17(15)23-18/h4-9,11-12H,2-3,10H2,1H3/b18-11- |
| InChIKey | XOFFLWBAFSUGNZ-WQRHYEAKSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|