C28H23ClN2O3 — CID 18823633
(2Z)-5-chloro-2-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-benzofuran-3-one (PubChem CID 18823633) has the molecular formula C28H23ClN2O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is (2Z)-5-chloro-2-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-5-chloro-2-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 18823633 |
| Molecular Formula | C28H23ClN2O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (2Z)-5-chloro-2-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-benzofuran-3-one |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\Oc3ccc(Cl)cc3C2=O)cc1C |
| InChI | InChI=1S/C28H23ClN2O3/c1-3-13-33-24-11-9-19(14-18(24)2)27-20(17-31(30-27)22-7-5-4-6-8-22)15-26-28(32)23-16-21(29)10-12-25(23)34-26/h4-12,14-17H,3,13H2,1-2H3/b26-15- |
| InChIKey | AGZVXIIKGJPKFR-YSMPRRRNSA-N |
| XLogP | 6.91 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|