C27H19ClN2O3 — CID 18823649
(2Z)-5-chloro-2-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-benzofuran-3-one (PubChem CID 18823649) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is (2Z)-5-chloro-2-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-5-chloro-2-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 18823649 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (2Z)-5-chloro-2-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-benzofuran-3-one |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\Oc3ccc(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H19ClN2O3/c1-2-14-32-22-11-8-18(9-12-22)26-19(17-30(29-26)21-6-4-3-5-7-21)15-25-27(31)23-16-20(28)10-13-24(23)33-25/h2-13,15-17H,1,14H2/b25-15- |
| InChIKey | NJTYXAQFGJFYIV-MYYYXRDXSA-N |
| XLogP | 6.37 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|