C28H24N4O3 — CID 19109567
(5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 19109567) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109567 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CC)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C28H24N4O3/c1-4-15-35-23-13-11-20(12-14-23)26-21(18-32(30-26)22-9-7-6-8-10-22)16-24-19(3)25(17-29)28(34)31(5-2)27(24)33/h4,6-14,16,18H,1,5,15H2,2-3H3/b24-16+ |
| InChIKey | WPUBTOAAGDBGPZ-LFVJCYFKSA-N |
| XLogP | 4.72 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|