C33H34N4O3 — CID 19110106
(5E)-1-hexyl-4-methyl-5-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110106) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is (5E)-1-hexyl-4-methyl-5-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-hexyl-4-methyl-5-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110106 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (5E)-1-hexyl-4-methyl-5-[[3-(3-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCCCC)C(=O)C(C#N)=C2C)cc1C |
| InChI | InChI=1S/C33H34N4O3/c1-5-7-8-12-17-36-32(38)28(24(4)29(21-34)33(36)39)20-26-22-37(27-13-10-9-11-14-27)35-31(26)25-15-16-30(23(3)19-25)40-18-6-2/h6,9-11,13-16,19-20,22H,2,5,7-8,12,17-18H2,1,3-4H3/b28-20+ |
| InChIKey | DDFONHNXTCVTOD-VFCFBJKWSA-N |
| XLogP | 6.59 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|