C23H17ClO4 — CID 19261037
(2Z)-6-[(4-chlorophenyl)methoxy]-2-[(2-methoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 19261037) has the molecular formula C23H17ClO4 and a molecular weight of 392.84 g/mol. Its IUPAC name is (2Z)-6-[(4-chlorophenyl)methoxy]-2-[(2-methoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(4-chlorophenyl)methoxy]-2-[(2-methoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 19261037 |
| Molecular Formula | C23H17ClO4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2Z)-6-[(4-chlorophenyl)methoxy]-2-[(2-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccccc1/C=C1\Oc2cc(OCc3ccc(Cl)cc3)ccc2C1=O |
| InChI | InChI=1S/C23H17ClO4/c1-26-20-5-3-2-4-16(20)12-22-23(25)19-11-10-18(13-21(19)28-22)27-14-15-6-8-17(24)9-7-15/h2-13H,14H2,1H3/b22-12- |
| InChIKey | RVIJOMPDUXSZJD-UUYOSTAYSA-N |
| XLogP | 5.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|