C23H15BrCl2O4 — CID 6519974
(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(3,4-dichlorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6519974) has the molecular formula C23H15BrCl2O4 and a molecular weight of 506.18 g/mol. Its IUPAC name is (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(3,4-dichlorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(3,4-dichlorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6519974 |
| Molecular Formula | C23H15BrCl2O4 |
| Molecular Weight | 506.18 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(3,4-dichlorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2C1=O |
| InChI | InChI=1S/C23H15BrCl2O4/c1-28-20-7-3-15(24)9-14(20)10-22-23(27)17-5-4-16(11-21(17)30-22)29-12-13-2-6-18(25)19(26)8-13/h2-11H,12H2,1H3/b22-10- |
| InChIKey | ZADRRCFKAHEBEE-YVNNLAQVSA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.18 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|