C25H21BrO4 — CID 2027367
(2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 2027367) has the molecular formula C25H21BrO4 and a molecular weight of 465.34 g/mol. Its IUPAC name is (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2027367 |
| Molecular Formula | C25H21BrO4 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | (2Z)-2-[(5-bromo-2-methoxyphenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | COc1ccc(Br)cc1/C=C1\Oc2cc(OCc3cc(C)ccc3C)ccc2C1=O |
| InChI | InChI=1S/C25H21BrO4/c1-15-4-5-16(2)18(10-15)14-29-20-7-8-21-23(13-20)30-24(25(21)27)12-17-11-19(26)6-9-22(17)28-3/h4-13H,14H2,1-3H3/b24-12- |
| InChIKey | RGWBWTPQFJDWLU-MSXFZWOLSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|