C23H20O3S — CID 2011537
(2E)-6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one (PubChem CID 2011537) has the molecular formula C23H20O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is (2E)-6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2011537 |
| Molecular Formula | C23H20O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2E)-6-[(2,5-dimethylphenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccc(C)c(COc2ccc3c(c2)O/C(=C/c2sccc2C)C3=O)c1 |
| InChI | InChI=1S/C23H20O3S/c1-14-4-5-15(2)17(10-14)13-25-18-6-7-19-20(11-18)26-21(23(19)24)12-22-16(3)8-9-27-22/h4-12H,13H2,1-3H3/b21-12+ |
| InChIKey | IQGLJGYVSLMCFE-CIAFOILYSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|