C21H15FO3S — CID 2027249
(2Z)-6-[(4-fluorophenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one (PubChem CID 2027249) has the molecular formula C21H15FO3S and a molecular weight of 366.41 g/mol. Its IUPAC name is (2Z)-6-[(4-fluorophenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(4-fluorophenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2027249 |
| Molecular Formula | C21H15FO3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2Z)-6-[(4-fluorophenyl)methoxy]-2-[(3-methylthiophen-2-yl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccsc1/C=C1\Oc2cc(OCc3ccc(F)cc3)ccc2C1=O |
| InChI | InChI=1S/C21H15FO3S/c1-13-8-9-26-20(13)11-19-21(23)17-7-6-16(10-18(17)25-19)24-12-14-2-4-15(22)5-3-14/h2-11H,12H2,1H3/b19-11- |
| InChIKey | WJNGBUXYQSZJGP-ODLFYWEKSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|