C21H16O4S — CID 6317829
(2Z)-6-[(4-methoxyphenyl)methoxy]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one (PubChem CID 6317829) has the molecular formula C21H16O4S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2Z)-6-[(4-methoxyphenyl)methoxy]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(4-methoxyphenyl)methoxy]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6317829 |
| Molecular Formula | C21H16O4S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (2Z)-6-[(4-methoxyphenyl)methoxy]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one |
| SMILES | COc1ccc(COc2ccc3c(c2)O/C(=C\c2cccs2)C3=O)cc1 |
| InChI | InChI=1S/C21H16O4S/c1-23-15-6-4-14(5-7-15)13-24-16-8-9-18-19(11-16)25-20(21(18)22)12-17-3-2-10-26-17/h2-12H,13H2,1H3/b20-12- |
| InChIKey | LQQUHURKLTYFFJ-NDENLUEZSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|